C15H22N6O2 — CID 175676425
(2R,3R,4S,5R)-4-amino-2-[6-(cyclopentylamino)purin-9-yl]-5-methyloxolan-3-ol (PubChem CID 175676425) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4-amino-2-[6-(cyclopentylamino)purin-9-yl]-5-methyloxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-4-amino-2-[6-(cyclopentylamino)purin-9-yl]-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 175676425 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2R,3R,4S,5R)-4-amino-2-[6-(cyclopentylamino)purin-9-yl]-5-methyloxolan-3-ol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)ncnc32)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C15H22N6O2/c1-8-10(16)12(22)15(23-8)21-7-19-11-13(17-6-18-14(11)21)20-9-4-2-3-5-9/h6-10,12,15,22H,2-5,16H2,1H3,(H,17,18,20)/t8-,10-,12-,15-/m1/s1 |
| InChIKey | ITDWPGFDKMIUBL-SJAJALHSSA-N |
| XLogP | 0.79 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |