C20H25N5O4 — CID 165345775
(2R,3R,4S,5R)-2-[6-(6-bicyclo[3.2.0]heptanylamino)purin-9-yl]-5-(prop-2-ynoxymethyl)oxolane-3,4-diol (PubChem CID 165345775) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(6-bicyclo[3.2.0]heptanylamino)purin-9-yl]-5-(prop-2-ynoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(6-bicyclo[3.2.0]heptanylamino)purin-9-yl]-5-(prop-2-ynoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 165345775 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(6-bicyclo[3.2.0]heptanylamino)purin-9-yl]-5-(prop-2-ynoxymethyl)oxolane-3,4-diol |
| SMILES | C#CCOC[C@H]1O[C@@H](n2cnc3c(NC4CC5CCCC54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25N5O4/c1-2-6-28-8-14-16(26)17(27)20(29-14)25-10-23-15-18(21-9-22-19(15)25)24-13-7-11-4-3-5-12(11)13/h1,9-14,16-17,20,26-27H,3-8H2,(H,21,22,24)/t11?,12?,13?,14-,16-,17-,20-/m1/s1 |
| InChIKey | MEQQJFFUHPWFNQ-BLHVBYPMSA-N |
| XLogP | 0.70 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|