C15H20N8O3 — CID 10832358
(2R,3R,4R,5S)-4-azido-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 10832358) has the molecular formula C15H20N8O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-azido-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-azido-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10832358 |
| Molecular Formula | C15H20N8O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (2R,3R,4R,5S)-4-azido-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O)[C@H](n2cnc3c(NC4CCCC4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C15H20N8O3/c16-22-21-10-9(5-24)26-15(12(10)25)23-7-19-11-13(17-6-18-14(11)23)20-8-3-1-2-4-8/h6-10,12,15,24-25H,1-5H2,(H,17,18,20)/t9-,10+,12-,15-/m1/s1 |
| InChIKey | NIBISTMBSRBOAU-KVQFHVITSA-N |
| XLogP | 1.11 |
| TPSA | 154.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|