C18H18N5O8P — CID 171428849
benzyl N-[9-[(2R,5S)-3-oxo-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]carbamate (PubChem CID 171428849) has the molecular formula C18H18N5O8P and a molecular weight of 463.34 g/mol. Its IUPAC name is benzyl N-[9-[(2R,5S)-3-oxo-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | benzyl N-[9-[(2R,5S)-3-oxo-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 171428849 |
| Molecular Formula | C18H18N5O8P |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | benzyl N-[9-[(2R,5S)-3-oxo-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)CC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N5O8P/c24-13-6-12(8-30-32(26,27)28)31-17(13)23-10-21-14-15(19-9-20-16(14)23)22-18(25)29-7-11-4-2-1-3-5-11/h1-5,9-10,12,17H,6-8H2,(H2,26,27,28)(H,19,20,22,25)/t12-,17+/m0/s1 |
| InChIKey | FPYFYFZCAMLFCO-YVEFUNNKSA-N |
| XLogP | 1.54 |
| TPSA | 174.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|