C34H33N5O6 — CID 70364936
[(2R,3R,4R,5S)-2-(6-benzamidopurin-9-yl)-4,5-bis(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 70364936) has the molecular formula C34H33N5O6 and a molecular weight of 607.67 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(6-benzamidopurin-9-yl)-4,5-bis(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2-(6-benzamidopurin-9-yl)-4,5-bis(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70364936 |
| Molecular Formula | C34H33N5O6 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(6-benzamidopurin-9-yl)-4,5-bis(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](COCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C34H33N5O6/c1-23(40)44-30-27(19-42-17-24-11-5-2-6-12-24)28(20-43-18-25-13-7-3-8-14-25)45-34(30)39-22-37-29-31(35-21-36-32(29)39)38-33(41)26-15-9-4-10-16-26/h2-16,21-22,27-28,30,34H,17-20H2,1H3,(H,35,36,38,41)/t27-,28-,30-,34-/m1/s1 |
| InChIKey | MLPHKMDJJNWSEL-APCLDRSVSA-N |
| XLogP | 4.96 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |