C18H19N5O3 — CID 126703595
N-[9-[(2R,3S)-3-ethoxy-4-methyloxetan-2-yl]purin-6-yl]benzamide (PubChem CID 126703595) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[9-[(2R,3S)-3-ethoxy-4-methyloxetan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S)-3-ethoxy-4-methyloxetan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 126703595 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[9-[(2R,3S)-3-ethoxy-4-methyloxetan-2-yl]purin-6-yl]benzamide |
| SMILES | CCO[C@H]1C(C)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C18H19N5O3/c1-3-25-14-11(2)26-18(14)23-10-21-13-15(19-9-20-16(13)23)22-17(24)12-7-5-4-6-8-12/h4-11,14,18H,3H2,1-2H3,(H,19,20,22,24)/t11?,14-,18+/m0/s1 |
| InChIKey | PSLXWBNZLPRDIM-IPUSRUPHSA-N |
| XLogP | 2.40 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |