C19H21N5O3 — CID 167636315
N-[9-[(2R,4R,5R)-5-ethyl-4-hydroxy-3-methyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 167636315) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[9-[(2R,4R,5R)-5-ethyl-4-hydroxy-3-methyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4R,5R)-5-ethyl-4-hydroxy-3-methyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 167636315 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[9-[(2R,4R,5R)-5-ethyl-4-hydroxy-3-methyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)C(C)[C@H]1O |
| InChI | InChI=1S/C19H21N5O3/c1-3-13-15(25)11(2)19(27-13)24-10-22-14-16(20-9-21-17(14)24)23-18(26)12-7-5-4-6-8-12/h4-11,13,15,19,25H,3H2,1-2H3,(H,20,21,23,26)/t11?,13-,15-,19-/m1/s1 |
| InChIKey | HURFTQYTJAKINP-FOHHQLAESA-N |
| XLogP | 2.38 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |