C36H34F2N10O6 — CID 163435381
N-[9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide;N-[9-[(2R,3R,5R)-5-ethyl-3-fluoro-4-oxooxolan-2-yl]purin-6-yl]benzamide (PubChem CID 163435381) has the molecular formula C36H34F2N10O6 and a molecular weight of 740.73 g/mol. Its IUPAC name is N-[9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide;N-[9-[(2R,3R,5R)-5-ethyl-3-fluoro-4-oxooxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide;N-[9-[(2R,3R,5R)-5-ethyl-3-fluoro-4-oxooxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 163435381 |
| Molecular Formula | C36H34F2N10O6 |
| Molecular Weight | 740.73 g/mol |
| Exact Mass | 740.26 |
| IUPAC Name | N-[9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide;N-[9-[(2R,3R,5R)-5-ethyl-3-fluoro-4-oxooxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)C1=O.CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C18H18FN5O3.C18H16FN5O3/c2*1-2-11-14(25)12(19)18(27-11)24-9-22-13-15(20-8-21-16(13)24)23-17(26)10-6-4-3-5-7-10/h3-9,11-12,14,18,25H,2H2,1H3,(H,20,21,23,26);3-9,11-12,18H,2H2,1H3,(H,20,21,23,26)/t11-,12+,14-,18-;11-,12+,18-/m11/s1 |
| InChIKey | AUAQCBIMBBKCRU-YTSAYFCCSA-N |
| XLogP | 4.38 |
| TPSA | 201.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |