C19H18FN5O5 — CID 163464988
[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-4-fluorooxolan-3-yl] hydrogen carbonate (PubChem CID 163464988) has the molecular formula C19H18FN5O5 and a molecular weight of 415.38 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-4-fluorooxolan-3-yl] hydrogen carbonate.
| Compound Name | [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-4-fluorooxolan-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 163464988 |
| Molecular Formula | C19H18FN5O5 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-4-fluorooxolan-3-yl] hydrogen carbonate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)[C@H]1OC(=O)O |
| InChI | InChI=1S/C19H18FN5O5/c1-2-11-14(30-19(27)28)12(20)18(29-11)25-9-23-13-15(21-8-22-16(13)25)24-17(26)10-6-4-3-5-7-10/h3-9,11-12,14,18H,2H2,1H3,(H,27,28)(H,21,22,24,26)/t11-,12+,14+,18-/m1/s1 |
| InChIKey | BRUIUTTZSKIGOL-BKTMZONDSA-N |
| XLogP | 2.79 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |