C23H31FN6O6P+ — CID 175761700
[5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine (PubChem CID 175761700) has the molecular formula C23H31FN6O6P+ and a molecular weight of 537.51 g/mol. Its IUPAC name is [5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine.
| Compound Name | [5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
|---|---|
| PubChem CID | 175761700 |
| Molecular Formula | C23H31FN6O6P+ |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | [5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=C(Nc1ncnc2c1ncn2C1OC(CO)C(O[P+](=O)O)C1F)c1ccccc1 |
| InChI | InChI=1S/C17H15FN5O6P.C6H15N/c18-11-13(29-30(26)27)10(6-24)28-17(11)23-8-21-12-14(19-7-20-15(12)23)22-16(25)9-4-2-1-3-5-9;1-4-7(5-2)6-3/h1-5,7-8,10-11,13,17,24H,6H2,(H-,19,20,22,25,26,27);4-6H2,1-3H3/p+1 |
| InChIKey | SCOVDTLEHHSJPA-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|