C20H20FN6O8P2S+ — CID 134395473
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 134395473) has the molecular formula C20H20FN6O8P2S+ and a molecular weight of 585.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 134395473 |
| Molecular Formula | C20H20FN6O8P2S+ |
| Molecular Weight | 585.43 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | N#CCCOP(O)(=S)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](F)[C@@H]1O[P+](=O)O |
| InChI | InChI=1S/C20H19FN6O8P2S/c21-14-16(35-36(29)30)13(9-33-37(31,38)32-8-4-7-22)34-20(14)27-11-25-15-17(23-10-24-18(15)27)26-19(28)12-5-2-1-3-6-12/h1-3,5-6,10-11,13-14,16,20H,4,8-9H2,(H2-,23,24,26,28,29,30,31,38)/p+1/t13-,14-,16-,20-,37?/m1/s1 |
| InChIKey | YJOWLLQNMVWCCB-GFIUTPSVSA-O |
| XLogP | 2.51 |
| TPSA | 190.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|