C23H24FN6O7P — CID 159829010
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate (PubChem CID 159829010) has the molecular formula C23H24FN6O7P and a molecular weight of 546.45 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate |
|---|---|
| PubChem CID | 159829010 |
| Molecular Formula | C23H24FN6O7P |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCCC#N)O[C@@H]1C(F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C23H24FN6O7P/c1-2-10-34-38(33,35-11-6-9-25)37-19-16(12-31)36-23(17(19)24)30-14-28-18-20(26-13-27-21(18)30)29-22(32)15-7-4-3-5-8-15/h2-5,7-8,13-14,16-17,19,23,31H,1,6,10-12H2,(H,26,27,29,32)/t16-,17?,19+,23-,38?/m1/s1 |
| InChIKey | NNFFYTCDVGPMCE-JZDWAPOWSA-N |
| XLogP | 2.93 |
| TPSA | 170.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|