C17H17N5O6P+ — CID 165174593
[(2R,3S,4R)-4-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 165174593) has the molecular formula C17H17N5O6P+ and a molecular weight of 418.33 g/mol. Its IUPAC name is [(2R,3S,4R)-4-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,4R)-4-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 165174593 |
| Molecular Formula | C17H17N5O6P+ |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [(2R,3S,4R)-4-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1CO[C@H](CO)[C@H]1O[P+](=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H16N5O6P/c23-6-12-14(28-29(25)26)11(7-27-12)22-9-20-13-15(18-8-19-16(13)22)21-17(24)10-4-2-1-3-5-10/h1-5,8-9,11-12,14,23H,6-7H2,(H-,18,19,21,24,25,26)/p+1/t11-,12-,14+/m1/s1 |
| InChIKey | URCNTKKPBIVAPP-BZPMIXESSA-O |
| XLogP | 1.05 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|