C21H23N5O4 — CID 155643412
N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-yl]benzamide (PubChem CID 155643412) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 155643412 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C21H23N5O4/c1-21(2)29-16-13(9-27)8-14(17(16)30-21)26-11-24-15-18(22-10-23-19(15)26)25-20(28)12-6-4-3-5-7-12/h3-7,10-11,13-14,16-17,27H,8-9H2,1-2H3,(H,22,23,25,28)/t13-,14-,16-,17+/m1/s1 |
| InChIKey | JSBLGVWVGMOBKZ-SRABZTEZSA-N |
| XLogP | 2.15 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |