C30H48N6O6PSi+ — CID 175737805
[(1R,2S,3R,5R)-3-(6-benzamidopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine (PubChem CID 175737805) has the molecular formula C30H48N6O6PSi+ and a molecular weight of 647.81 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-3-(6-benzamidopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine.
| Compound Name | [(1R,2S,3R,5R)-3-(6-benzamidopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
|---|---|
| PubChem CID | 175737805 |
| Molecular Formula | C30H48N6O6PSi+ |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | [(1R,2S,3R,5R)-3-(6-benzamidopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)cyclopentyl]oxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[P+](=O)O)[C@@H](CO)C[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21.CCN(CC)CC |
| InChI | InChI=1S/C24H32N5O6PSi.C6H15N/c1-24(2,3)37(4,5)35-20-17(11-16(12-30)19(20)34-36(32)33)29-14-27-18-21(25-13-26-22(18)29)28-23(31)15-9-7-6-8-10-15;1-4-7(5-2)6-3/h6-10,13-14,16-17,19-20,30H,11-12H2,1-5H3,(H-,25,26,28,31,32,33);4-6H2,1-3H3/p+1/t16-,17-,19-,20+;/m1./s1 |
| InChIKey | LKTOHYWQXBDCBS-NKFSPJOCSA-O |
| XLogP | 5.41 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|