C35H57N5O4SiSn — CID 11657816
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanolate;tributylstannanylium (PubChem CID 11657816) has the molecular formula C35H57N5O4SiSn and a molecular weight of 758.67 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanolate;tributylstannanylium.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanolate;tributylstannanylium |
|---|---|
| PubChem CID | 11657816 |
| Molecular Formula | C35H57N5O4SiSn |
| Molecular Weight | 758.67 g/mol |
| Exact Mass | 759.32 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanolate;tributylstannanylium |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1C[O-].CCCC[Sn+](CCCC)CCCC |
| InChI | InChI=1S/C23H30N5O4Si.3C4H9.Sn/c1-23(2,3)33(4,5)32-16-11-18(31-17(16)12-29)28-14-26-19-20(24-13-25-21(19)28)27-22(30)15-9-7-6-8-10-15;3*1-3-4-2;/h6-10,13-14,16-18H,11-12H2,1-5H3,(H,24,25,27,30);3*1,3-4H2,2H3;/q-1;;;;+1/t16-,17+,18+;;;;/m0..../s1 |
| InChIKey | RTHZGWVVZHISAV-PIKIAGLTSA-N |
| XLogP | 8.00 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|