C17H17N5O4 — CID 178066679
N-[9-[(3R,4S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]purin-6-yl]benzamide (PubChem CID 178066679) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[9-[(3R,4S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3R,4S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 178066679 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[9-[(3R,4S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1COC(CO)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C17H17N5O4/c23-6-12-14(24)11(7-26-12)22-9-20-13-15(18-8-19-16(13)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-12,14,23-24H,6-7H2,(H,18,19,21,25)/t11-,12?,14+/m1/s1 |
| InChIKey | OAJUFOISSWJHQD-SOGVLRHJSA-N |
| XLogP | 0.37 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |