C16H14FN5O3 — CID 175295617
N-[9-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 175295617) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 175295617 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[9-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1OC[C@@H](O)[C@H]1F)c1ccccc1 |
| InChI | InChI=1S/C16H14FN5O3/c17-11-10(23)6-25-16(11)22-8-20-12-13(18-7-19-14(12)22)21-15(24)9-4-2-1-3-5-9/h1-5,7-8,10-11,16,23H,6H2,(H,18,19,21,24)/t10-,11-,16-/m1/s1 |
| InChIKey | KVTOHHCJVPEGQA-GLKRBJQHSA-N |
| XLogP | 1.31 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |