C22H19N5O2Se — CID 10576087
N-[9-[(2R,3R)-3-phenylselanyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10576087) has the molecular formula C22H19N5O2Se and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[9-[(2R,3R)-3-phenylselanyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R)-3-phenylselanyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10576087 |
| Molecular Formula | C22H19N5O2Se |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[9-[(2R,3R)-3-phenylselanyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1OCC[C@H]1[Se]c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2Se/c28-21(15-7-3-1-4-8-15)26-19-18-20(24-13-23-19)27(14-25-18)22-17(11-12-29-22)30-16-9-5-2-6-10-16/h1-10,13-14,17,22H,11-12H2,(H,23,24,26,28)/t17-,22-/m1/s1 |
| InChIKey | FDVAHMYEVGBKCW-VGOFRKELSA-N |
| XLogP | 2.82 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|