C23H17N5O5 — CID 71812556
[(2R,3S)-2-(6-benzamidopurin-9-yl)-4-oxooxolan-3-yl] benzoate (PubChem CID 71812556) has the molecular formula C23H17N5O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is [(2R,3S)-2-(6-benzamidopurin-9-yl)-4-oxooxolan-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-(6-benzamidopurin-9-yl)-4-oxooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 71812556 |
| Molecular Formula | C23H17N5O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(2R,3S)-2-(6-benzamidopurin-9-yl)-4-oxooxolan-3-yl] benzoate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1OCC(=O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17N5O5/c29-16-11-32-22(18(16)33-23(31)15-9-5-2-6-10-15)28-13-26-17-19(24-12-25-20(17)28)27-21(30)14-7-3-1-4-8-14/h1-10,12-13,18,22H,11H2,(H,24,25,27,30)/t18-,22-/m1/s1 |
| InChIKey | XRNHGVYFJUOXEC-XMSQKQJNSA-N |
| XLogP | 2.40 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |