C38H29N5O7S — CID 99653802
[(2S,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-benzoyloxy-3-benzoylsulfanyloxolan-2-yl]methyl benzoate (PubChem CID 99653802) has the molecular formula C38H29N5O7S and a molecular weight of 699.75 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-benzoyloxy-3-benzoylsulfanyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-benzoyloxy-3-benzoylsulfanyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 99653802 |
| Molecular Formula | C38H29N5O7S |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | [(2S,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-benzoyloxy-3-benzoylsulfanyloxolan-2-yl]methyl benzoate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@@H](COC(=O)c2ccccc2)[C@@H](SC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H29N5O7S/c44-34(24-13-5-1-6-14-24)42-32-29-33(40-22-39-32)43(23-41-29)35-30(50-37(46)26-17-9-3-10-18-26)31(51-38(47)27-19-11-4-12-20-27)28(49-35)21-48-36(45)25-15-7-2-8-16-25/h1-20,22-23,28,30-31,35H,21H2,(H,39,40,42,44)/t28-,30-,31+,35+/m0/s1 |
| InChIKey | LTCYQNMBODKANE-PPAXEIQDSA-N |
| XLogP | 6.00 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|