C29H30N5O9P — CID 102438995
[(2S,3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2-diethoxyphosphoryl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 102438995) has the molecular formula C29H30N5O9P and a molecular weight of 623.56 g/mol. Its IUPAC name is [(2S,3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2-diethoxyphosphoryl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(2S,3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2-diethoxyphosphoryl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 102438995 |
| Molecular Formula | C29H30N5O9P |
| Molecular Weight | 623.56 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | [(2S,3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2-diethoxyphosphoryl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CCOP(=O)(OCC)[C@@H]1O[C@@H]2[C@H](O1)[C@@H](COC(=O)c1ccccc1)O[C@H]2n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C29H30N5O9P/c1-3-39-44(37,40-4-2)29-42-22-20(15-38-28(36)19-13-9-6-10-14-19)41-27(23(22)43-29)34-17-32-21-24(30-16-31-25(21)34)33-26(35)18-11-7-5-8-12-18/h5-14,16-17,20,22-23,27,29H,3-4,15H2,1-2H3,(H,30,31,33,35)/t20-,22-,23-,27-,29+/m1/s1 |
| InChIKey | CSHYDBVTRCXHEH-GQOKGYLCSA-N |
| XLogP | 4.17 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|