C24H19N5O8S — CID 51056054
[(3aS,4R,6R,6aS)-4-(6-benzamidopurin-9-yl)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-6-yl]methyl benzoate (PubChem CID 51056054) has the molecular formula C24H19N5O8S and a molecular weight of 537.51 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-4-(6-benzamidopurin-9-yl)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-6-yl]methyl benzoate.
| Compound Name | [(3aS,4R,6R,6aS)-4-(6-benzamidopurin-9-yl)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 51056054 |
| Molecular Formula | C24H19N5O8S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | [(3aS,4R,6R,6aS)-4-(6-benzamidopurin-9-yl)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-6-yl]methyl benzoate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H]2OS(=O)(=O)O[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C24H19N5O8S/c30-22(14-7-3-1-4-8-14)28-20-17-21(26-12-25-20)29(13-27-17)23-19-18(36-38(32,33)37-19)16(35-23)11-34-24(31)15-9-5-2-6-10-15/h1-10,12-13,16,18-19,23H,11H2,(H,25,26,28,30)/t16-,18+,19+,23-/m1/s1 |
| InChIKey | NUORHDQEVYHNDG-ZQDYSYBYSA-N |
| XLogP | 1.86 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |