C40H39N5O7 — CID 146628712
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-[di(cyclobutyl)methylamino]purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 146628712) has the molecular formula C40H39N5O7 and a molecular weight of 701.78 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-[di(cyclobutyl)methylamino]purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-[di(cyclobutyl)methylamino]purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 146628712 |
| Molecular Formula | C40H39N5O7 |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 701.28 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-[di(cyclobutyl)methylamino]purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(NC(C4CCC4)C4CCC4)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H39N5O7/c46-38(27-12-4-1-5-13-27)49-22-30-33(51-39(47)28-14-6-2-7-15-28)34(52-40(48)29-16-8-3-9-17-29)37(50-30)45-24-43-32-35(41-23-42-36(32)45)44-31(25-18-10-19-25)26-20-11-21-26/h1-9,12-17,23-26,30-31,33-34,37H,10-11,18-22H2,(H,41,42,44)/t30-,33-,34-,37-/m1/s1 |
| InChIKey | PGCPOVBPEKVHTH-KKKGQUFWSA-N |
| XLogP | 6.41 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|