C37H37N5O7 — CID 10908507
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(hexylamino)purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 10908507) has the molecular formula C37H37N5O7 and a molecular weight of 663.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(hexylamino)purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(hexylamino)purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10908507 |
| Molecular Formula | C37H37N5O7 |
| Molecular Weight | 663.73 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(hexylamino)purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H37N5O7/c1-2-3-4-14-21-38-32-29-33(40-23-39-32)42(24-41-29)34-31(49-37(45)27-19-12-7-13-20-27)30(48-36(44)26-17-10-6-11-18-26)28(47-34)22-46-35(43)25-15-8-5-9-16-25/h5-13,15-20,23-24,28,30-31,34H,2-4,14,21-22H2,1H3,(H,38,39,40)/t28-,30-,31-,34-/m1/s1 |
| InChIKey | IFTHGIURPFJXDY-UTBAFCPYSA-N |
| XLogP | 6.02 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|