C23H32N6O8 — CID 53462433
[5-[6-[(4-amino-4-oxobutyl)amino]purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate (PubChem CID 53462433) has the molecular formula C23H32N6O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is [5-[6-[(4-amino-4-oxobutyl)amino]purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate.
| Compound Name | [5-[6-[(4-amino-4-oxobutyl)amino]purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 53462433 |
| Molecular Formula | C23H32N6O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [5-[6-[(4-amino-4-oxobutyl)amino]purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1OC(n2cnc3c(NCCCC(N)=O)ncnc32)C(OC(=O)CC)C1OC(=O)CC |
| InChI | InChI=1S/C23H32N6O8/c1-4-15(31)34-10-13-19(36-16(32)5-2)20(37-17(33)6-3)23(35-13)29-12-28-18-21(26-11-27-22(18)29)25-9-7-8-14(24)30/h11-13,19-20,23H,4-10H2,1-3H3,(H2,24,30)(H,25,26,27) |
| InChIKey | YDAFJDAEPUHFIH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 186.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|