C30H45N5O8 — CID 102155655
[(2R,3R,4R,5R)-5-[6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102155655) has the molecular formula C30H45N5O8 and a molecular weight of 603.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-[6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102155655 |
| Molecular Formula | C30H45N5O8 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H45N5O8/c1-27(2,3)23(36)34-20-17-21(32-14-31-20)35(15-33-17)22-19(43-26(39)30(10,11)12)18(42-25(38)29(7,8)9)16(41-22)13-40-24(37)28(4,5)6/h14-16,18-19,22H,13H2,1-12H3,(H,31,32,34,36)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | NPGYNVBCPFDCHW-WGQQHEPDSA-N |
| XLogP | 4.21 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|