C24H33N5O8 — CID 98539505
[(2S,3R,4R,5R)-3,4-diacetyloxy-5-[6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 98539505) has the molecular formula C24H33N5O8 and a molecular weight of 519.56 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98539505 |
| Molecular Formula | C24H33N5O8 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4-diacetyloxy-5-[6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCCCCCCC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H33N5O8/c1-5-6-7-8-9-10-18(33)28-22-19-23(26-12-25-22)29(13-27-19)24-21(36-16(4)32)20(35-15(3)31)17(37-24)11-34-14(2)30/h12-13,17,20-21,24H,5-11H2,1-4H3,(H,25,26,28,33)/t17-,20+,21+,24+/m0/s1 |
| InChIKey | RKXFARRTYWTTSH-FCIXZNIRSA-N |
| XLogP | 2.45 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|