C16H17N7O7 — CID 85115631
[3,4-diacetyloxy-5-(6-azidopurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 85115631) has the molecular formula C16H17N7O7 and a molecular weight of 419.35 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-(6-azidopurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-(6-azidopurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 85115631 |
| Molecular Formula | C16H17N7O7 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [3,4-diacetyloxy-5-(6-azidopurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(N=[N+]=[N-])ncnc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H17N7O7/c1-7(24)27-4-10-12(28-8(2)25)13(29-9(3)26)16(30-10)23-6-20-11-14(21-22-17)18-5-19-15(11)23/h5-6,10,12-13,16H,4H2,1-3H3 |
| InChIKey | YIMKPCGDQZLATJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 180.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|