C20H20N4O8 — CID 11510556
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 11510556) has the molecular formula C20H20N4O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11510556 |
| Molecular Formula | C20H20N4O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(-c4ccoc4)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H20N4O8/c1-10(25)29-7-14-17(30-11(2)26)18(31-12(3)27)20(32-14)24-9-23-16-15(13-4-5-28-6-13)21-8-22-19(16)24/h4-6,8-9,14,17-18,20H,7H2,1-3H3/t14-,17-,18-,20-/m1/s1 |
| InChIKey | AMPVNGDPTHZKPV-VXXKDZQQSA-N |
| XLogP | 1.41 |
| TPSA | 144.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|