C20H20N4O7S — CID 141049958
[(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(6-thiophen-3-ylpurin-9-yl)oxolan-2-yl]methyl 2-deuterioacetate (PubChem CID 141049958) has the molecular formula C20H20N4O7S and a molecular weight of 463.49 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(6-thiophen-3-ylpurin-9-yl)oxolan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(6-thiophen-3-ylpurin-9-yl)oxolan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141049958 |
| Molecular Formula | C20H20N4O7S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(6-thiophen-3-ylpurin-9-yl)oxolan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cnc3c(-c4ccsc4)ncnc32)[C@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C20H20N4O7S/c1-10(25)28-6-14-17(29-11(2)26)18(30-12(3)27)20(31-14)24-9-23-16-15(13-4-5-32-7-13)21-8-22-19(16)24/h4-5,7-9,14,17-18,20H,6H2,1-3H3/t14-,17-,18-,20?/m1/s1/i1D,2D,3D |
| InChIKey | HTRXNMVBNSKZFS-RXTCXONTSA-N |
| XLogP | 1.88 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|