C25H26N4O10 — CID 166453699
[(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(3,5-dimethoxybenzoyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate (PubChem CID 166453699) has the molecular formula C25H26N4O10 and a molecular weight of 545.52 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(3,5-dimethoxybenzoyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(3,5-dimethoxybenzoyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 166453699 |
| Molecular Formula | C25H26N4O10 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(3,5-dimethoxybenzoyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cnc3c(C(=O)c4cc(OC)cc(OC)c4)ncnc32)[C@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C25H26N4O10/c1-12(30)36-9-18-22(37-13(2)31)23(38-14(3)32)25(39-18)29-11-28-20-19(26-10-27-24(20)29)21(33)15-6-16(34-4)8-17(7-15)35-5/h6-8,10-11,18,22-23,25H,9H2,1-5H3/t18-,22-,23-,25?/m1/s1/i1D,2D,3D |
| InChIKey | VBMAGXKKMJAKHH-XMPTYCACSA-N |
| XLogP | 1.40 |
| TPSA | 167.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|