C23H21ClN4O8 — CID 166453693
[(2R,3R,4R)-5-[6-(4-chlorobenzoyl)purin-9-yl]-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate (PubChem CID 166453693) has the molecular formula C23H21ClN4O8 and a molecular weight of 519.91 g/mol. Its IUPAC name is [(2R,3R,4R)-5-[6-(4-chlorobenzoyl)purin-9-yl]-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-5-[6-(4-chlorobenzoyl)purin-9-yl]-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 166453693 |
| Molecular Formula | C23H21ClN4O8 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | [(2R,3R,4R)-5-[6-(4-chlorobenzoyl)purin-9-yl]-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cnc3c(C(=O)c4ccc(Cl)cc4)ncnc32)[C@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C23H21ClN4O8/c1-11(29)33-8-16-20(34-12(2)30)21(35-13(3)31)23(36-16)28-10-27-18-17(25-9-26-22(18)28)19(32)14-4-6-15(24)7-5-14/h4-7,9-10,16,20-21,23H,8H2,1-3H3/t16-,20-,21-,23?/m1/s1/i1D,2D,3D |
| InChIKey | FDDSNLDJQMLKFF-YRMMXHDGSA-N |
| XLogP | 2.03 |
| TPSA | 148.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|