C28H26N4O8 — CID 166453679
[(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(2-naphthalen-2-yl-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate (PubChem CID 166453679) has the molecular formula C28H26N4O8 and a molecular weight of 549.55 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(2-naphthalen-2-yl-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(2-naphthalen-2-yl-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 166453679 |
| Molecular Formula | C28H26N4O8 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-[6-(2-naphthalen-2-yl-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cnc3c(CC(=O)c4ccc5ccccc5c4)ncnc32)[C@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C28H26N4O8/c1-15(33)37-12-23-25(38-16(2)34)26(39-17(3)35)28(40-23)32-14-31-24-21(29-13-30-27(24)32)11-22(36)20-9-8-18-6-4-5-7-19(18)10-20/h4-10,13-14,23,25-26,28H,11-12H2,1-3H3/t23-,25-,26-,28?/m1/s1/i1D,2D,3D |
| InChIKey | HQXFFEXMTAWUAH-YGWUZDNCSA-N |
| XLogP | 2.73 |
| TPSA | 148.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|