C35H30N4O9 — CID 13097157
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(2-ethoxy-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 13097157) has the molecular formula C35H30N4O9 and a molecular weight of 650.64 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(2-ethoxy-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(2-ethoxy-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 13097157 |
| Molecular Formula | C35H30N4O9 |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(2-ethoxy-2-oxoethyl)purin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CCOC(=O)Cc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H30N4O9/c1-2-44-27(40)18-25-28-31(37-20-36-25)39(21-38-28)32-30(48-35(43)24-16-10-5-11-17-24)29(47-34(42)23-14-8-4-9-15-23)26(46-32)19-45-33(41)22-12-6-3-7-13-22/h3-17,20-21,26,29-30,32H,2,18-19H2,1H3/t26-,29-,30-,32-/m1/s1 |
| InChIKey | IFPHPXNVYKRWBJ-BNXUFIDZSA-N |
| XLogP | 4.14 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|