C20H21N5O8 — CID 66906330
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-8-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 66906330) has the molecular formula C20H21N5O8 and a molecular weight of 459.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-8-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-8-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66906330 |
| Molecular Formula | C20H21N5O8 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-8-(furan-3-yl)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(-c3ccoc3)nc3c(N)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H21N5O8/c1-9(26)30-7-13-15(31-10(2)27)16(32-11(3)28)20(33-13)25-18(12-4-5-29-6-12)24-14-17(21)22-8-23-19(14)25/h4-6,8,13,15-16,20H,7H2,1-3H3,(H2,21,22,23)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | DRVWIFIKPPWGLW-KHTYJDQRSA-N |
| XLogP | 0.99 |
| TPSA | 170.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|