C16H19N5O7S — CID 90671943
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-methylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 90671943) has the molecular formula C16H19N5O7S and a molecular weight of 425.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-methylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-methylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90671943 |
| Molecular Formula | C16H19N5O7S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(7-methylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CSc1ncnc2c1nnn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H19N5O7S/c1-7(22)25-5-10-12(26-8(2)23)13(27-9(3)24)16(28-10)21-14-11(19-20-21)15(29-4)18-6-17-14/h6,10,12-13,16H,5H2,1-4H3/t10-,12-,13-,16-/m1/s1 |
| InChIKey | SZMPBDYAJIZZBE-XNIJJKJLSA-N |
| XLogP | 0.27 |
| TPSA | 144.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|