C19H23N5O11 — CID 136704937
[(2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-(6-methyl-5,7-dioxo-4H-triazolo[4,5-d]pyrimidin-3-yl)oxan-2-yl]methyl acetate (PubChem CID 136704937) has the molecular formula C19H23N5O11 and a molecular weight of 497.42 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-(6-methyl-5,7-dioxo-4H-triazolo[4,5-d]pyrimidin-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-(6-methyl-5,7-dioxo-4H-triazolo[4,5-d]pyrimidin-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 136704937 |
| Molecular Formula | C19H23N5O11 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-(6-methyl-5,7-dioxo-4H-triazolo[4,5-d]pyrimidin-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](n2nnc3c(=O)n(C)c(=O)[nH]c32)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H23N5O11/c1-7(25)31-6-11-13(32-8(2)26)14(33-9(3)27)15(34-10(4)28)18(35-11)24-16-12(21-22-24)17(29)23(5)19(30)20-16/h11,13-15,18H,6H2,1-5H3,(H,20,30)/t11-,13-,14-,15-,18+/m0/s1 |
| InChIKey | NIXWENKTWFOKRO-GKHXFJEZSA-N |
| XLogP | -1.93 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|