C23H34F3N3O9Si — CID 53230978
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[tert-butyl(dimethyl)silyl]-5-(trifluoromethyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 53230978) has the molecular formula C23H34F3N3O9Si and a molecular weight of 581.62 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[tert-butyl(dimethyl)silyl]-5-(trifluoromethyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[tert-butyl(dimethyl)silyl]-5-(trifluoromethyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 53230978 |
| Molecular Formula | C23H34F3N3O9Si |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[tert-butyl(dimethyl)silyl]-5-(trifluoromethyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2nnc([Si](C)(C)C(C)(C)C)c2C(F)(F)F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H34F3N3O9Si/c1-11(30)34-10-15-16(35-12(2)31)17(36-13(3)32)18(37-14(4)33)21(38-15)29-19(23(24,25)26)20(27-28-29)39(8,9)22(5,6)7/h15-18,21H,10H2,1-9H3/t15-,16+,17+,18-,21-/m1/s1 |
| InChIKey | PTXGAGRPJAWJEQ-BWZHCXAASA-N |
| XLogP | 2.27 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|