C26H25N5O9 — CID 4979471
[3,4,5-triacetyloxy-6-(triazolo[4,5-b]phenazin-3-yl)oxan-2-yl]methyl acetate (PubChem CID 4979471) has the molecular formula C26H25N5O9 and a molecular weight of 551.51 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(triazolo[4,5-b]phenazin-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(triazolo[4,5-b]phenazin-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4979471 |
| Molecular Formula | C26H25N5O9 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(triazolo[4,5-b]phenazin-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2nnc3cc4nc5ccccc5nc4cc32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H25N5O9/c1-12(32)36-11-22-23(37-13(2)33)24(38-14(3)34)25(39-15(4)35)26(40-22)31-21-10-19-18(9-20(21)29-30-31)27-16-7-5-6-8-17(16)28-19/h5-10,22-26H,11H2,1-4H3 |
| InChIKey | LQSSIRRDWISCCN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 170.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|