C38H27N5O7 — CID 4979469
[3,4-dibenzoyloxy-5-(triazolo[4,5-b]phenazin-3-yl)oxolan-2-yl]methyl benzoate (PubChem CID 4979469) has the molecular formula C38H27N5O7 and a molecular weight of 665.66 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(triazolo[4,5-b]phenazin-3-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(triazolo[4,5-b]phenazin-3-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 4979469 |
| Molecular Formula | C38H27N5O7 |
| Molecular Weight | 665.66 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(triazolo[4,5-b]phenazin-3-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(n2nnc3cc4nc5ccccc5nc4cc32)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H27N5O7/c44-36(23-12-4-1-5-13-23)47-22-32-33(49-37(45)24-14-6-2-7-15-24)34(50-38(46)25-16-8-3-9-17-25)35(48-32)43-31-21-29-28(20-30(31)41-42-43)39-26-18-10-11-19-27(26)40-29/h1-21,32-35H,22H2 |
| InChIKey | DTWXWTDISTXWCE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 144.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|