C40H31N3O9 — CID 102025449
[(2R,3R,4S,5S,6R)-6-(benzotriazol-1-yl)-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 102025449) has the molecular formula C40H31N3O9 and a molecular weight of 697.70 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-(benzotriazol-1-yl)-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-(benzotriazol-1-yl)-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102025449 |
| Molecular Formula | C40H31N3O9 |
| Molecular Weight | 697.70 g/mol |
| Exact Mass | 697.21 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-(benzotriazol-1-yl)-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2nnc3ccccc32)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H31N3O9/c44-37(26-15-5-1-6-16-26)48-25-32-33(50-38(45)27-17-7-2-8-18-27)34(51-39(46)28-19-9-3-10-20-28)35(52-40(47)29-21-11-4-12-22-29)36(49-32)43-31-24-14-13-23-30(31)41-42-43/h1-24,32-36H,25H2/t32-,33-,34+,35+,36-/m1/s1 |
| InChIKey | NZFSLIWYRIGLDU-DQROVBKRSA-N |
| XLogP | 5.86 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|