C41H37N3O11 — CID 102025454
tert-butyl 1-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]triazole-4-carboxylate (PubChem CID 102025454) has the molecular formula C41H37N3O11 and a molecular weight of 747.76 g/mol. Its IUPAC name is tert-butyl 1-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]triazole-4-carboxylate.
| Compound Name | tert-butyl 1-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 102025454 |
| Molecular Formula | C41H37N3O11 |
| Molecular Weight | 747.76 g/mol |
| Exact Mass | 747.24 |
| IUPAC Name | tert-butyl 1-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]triazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)nn1 |
| InChI | InChI=1S/C41H37N3O11/c1-41(2,3)55-40(49)30-24-44(43-42-30)35-34(54-39(48)29-22-14-7-15-23-29)33(53-38(47)28-20-12-6-13-21-28)32(52-37(46)27-18-10-5-11-19-27)31(51-35)25-50-36(45)26-16-8-4-9-17-26/h4-24,31-35H,25H2,1-3H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | AROATOQKHWSTRW-CKQPALCZSA-N |
| XLogP | 5.66 |
| TPSA | 171.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|