C36H34N2O9Si — CID 54002496
methyl 1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(benzoyloxymethyl)oxolan-2-yl]-4-(2-trimethylsilylethynyl)pyrazole-3-carboxylate (PubChem CID 54002496) has the molecular formula C36H34N2O9Si and a molecular weight of 666.76 g/mol. Its IUPAC name is methyl 1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(benzoyloxymethyl)oxolan-2-yl]-4-(2-trimethylsilylethynyl)pyrazole-3-carboxylate.
| Compound Name | methyl 1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(benzoyloxymethyl)oxolan-2-yl]-4-(2-trimethylsilylethynyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 54002496 |
| Molecular Formula | C36H34N2O9Si |
| Molecular Weight | 666.76 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | methyl 1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(benzoyloxymethyl)oxolan-2-yl]-4-(2-trimethylsilylethynyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C36H34N2O9Si/c1-43-36(42)29-27(20-21-48(2,3)4)22-38(37-29)32-31(47-35(41)26-18-12-7-13-19-26)30(46-34(40)25-16-10-6-11-17-25)28(45-32)23-44-33(39)24-14-8-5-9-15-24/h5-19,22,28,30-32H,23H2,1-4H3/t28-,30-,31-,32-/m1/s1 |
| InChIKey | KMPJGIFQIZSFRX-PYTKSMOKSA-N |
| XLogP | 5.10 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|