C28H36N2O9 — CID 141224179
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-benzyl-3-tert-butylpyrazol-1-yl)oxan-2-yl]methyl acetate (PubChem CID 141224179) has the molecular formula C28H36N2O9 and a molecular weight of 544.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-benzyl-3-tert-butylpyrazol-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-benzyl-3-tert-butylpyrazol-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141224179 |
| Molecular Formula | C28H36N2O9 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-benzyl-3-tert-butylpyrazol-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2nc(C(C)(C)C)cc2Cc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H36N2O9/c1-16(31)35-15-22-24(36-17(2)32)25(37-18(3)33)26(38-19(4)34)27(39-22)30-21(13-20-11-9-8-10-12-20)14-23(29-30)28(5,6)7/h8-12,14,22,24-27H,13,15H2,1-7H3/t22-,24-,25+,26-,27-/m1/s1 |
| InChIKey | XTOCALMLZBPUBR-UIKHAHSZSA-N |
| XLogP | 3.03 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|