C24H28N4O10S — CID 102473011
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-amino-6-benzyl-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl)oxan-2-yl]methyl acetate (PubChem CID 102473011) has the molecular formula C24H28N4O10S and a molecular weight of 564.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-amino-6-benzyl-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-amino-6-benzyl-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102473011 |
| Molecular Formula | C24H28N4O10S |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-amino-6-benzyl-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2nc(Cc3ccccc3)c(=O)n(N)c2=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H28N4O10S/c1-12(29)34-11-18-19(35-13(2)30)20(36-14(3)31)21(37-15(4)32)23(38-18)28-24(39)27(25)22(33)17(26-28)10-16-8-6-5-7-9-16/h5-9,18-21,23H,10-11,25H2,1-4H3/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | IKIQQXIYSSQXCR-ZFVIQDPVSA-N |
| XLogP | 0.33 |
| TPSA | 180.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|