C22H25N3O9S — CID 98316410
[(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(5-phenyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)oxan-2-yl]methyl acetate (PubChem CID 98316410) has the molecular formula C22H25N3O9S and a molecular weight of 507.52 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(5-phenyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(5-phenyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98316410 |
| Molecular Formula | C22H25N3O9S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(5-phenyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)O[C@@H]1n1nc(-c2ccccc2)oc1=S |
| InChI | InChI=1S/C22H25N3O9S/c1-11(26)23-17-19(32-14(4)29)18(31-13(3)28)16(10-30-12(2)27)33-21(17)25-22(35)34-20(24-25)15-8-6-5-7-9-15/h5-9,16-19,21H,10H2,1-4H3,(H,23,26)/t16-,17+,18+,19-,21-/m0/s1 |
| InChIKey | LTFACHGUFVRXCD-KKKDIUQISA-N |
| XLogP | 1.70 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|