C26H28N4O9S — CID 56595640
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(5-cyano-2-methylsulfanyl-4-oxo-6-phenylpyrimidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 56595640) has the molecular formula C26H28N4O9S and a molecular weight of 572.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(5-cyano-2-methylsulfanyl-4-oxo-6-phenylpyrimidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(5-cyano-2-methylsulfanyl-4-oxo-6-phenylpyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56595640 |
| Molecular Formula | C26H28N4O9S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-(5-cyano-2-methylsulfanyl-4-oxo-6-phenylpyrimidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CSc1nc(=O)c(C#N)c(-c2ccccc2)n1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C26H28N4O9S/c1-13(31)28-20-23(38-16(4)34)22(37-15(3)33)19(12-36-14(2)32)39-25(20)30-21(17-9-7-6-8-10-17)18(11-27)24(35)29-26(30)40-5/h6-10,19-20,22-23,25H,12H2,1-5H3,(H,28,31)/t19-,20-,22-,23-,25-/m1/s1 |
| InChIKey | KSBOSYULENOMFF-HPUHJGTRSA-N |
| XLogP | 1.33 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|