C33H32N2O10S — CID 96582610
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-sulfanylidene-1-pyridinyl]oxan-2-yl]methyl acetate (PubChem CID 96582610) has the molecular formula C33H32N2O10S and a molecular weight of 648.69 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-sulfanylidene-1-pyridinyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-sulfanylidene-1-pyridinyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 96582610 |
| Molecular Formula | C33H32N2O10S |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-sulfanylidene-1-pyridinyl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)n([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3OC(C)=O)c(=S)c2C#N)cc1 |
| InChI | InChI=1S/C33H32N2O10S/c1-18(36)41-17-28-29(42-19(2)37)30(43-20(3)38)31(44-21(4)39)32(45-28)35-27(23-9-7-6-8-10-23)15-25(26(16-34)33(35)46)22-11-13-24(40-5)14-12-22/h6-15,28-32H,17H2,1-5H3/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | CTPGLRSMEZXAFK-DSSMMGBBSA-N |
| XLogP | 4.69 |
| TPSA | 152.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|