C32H34N4O10S — CID 71596075
[3,4,5-triacetyloxy-6-[[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 71596075) has the molecular formula C32H34N4O10S and a molecular weight of 666.71 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71596075 |
| Molecular Formula | C32H34N4O10S |
| Molecular Weight | 666.71 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(NC(=S)NC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)n2)cc1 |
| InChI | InChI=1S/C32H34N4O10S/c1-17(37)42-16-26-27(43-18(2)38)28(44-19(3)39)29(45-20(4)40)30(46-26)35-32(47)36-31-33-24(21-9-7-6-8-10-21)15-25(34-31)22-11-13-23(41-5)14-12-22/h6-15,26-30H,16H2,1-5H3,(H2,33,34,35,36,47) |
| InChIKey | YTFALPIDODZBDW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|